About 3-bromo-N,N-diphenylthiophen-2-amine
3-bromo-N,N-diphenylthiophen-2-amine (PubChem CID 167081658) has the molecular formula C16H12BrNS
and a molecular weight of 330.25 g/mol. Its IUPAC name is 3-bromo-N,N-diphenylthiophen-2-amine.
Molecular Properties
| Compound Name | 3-bromo-N,N-diphenylthiophen-2-amine |
| PubChem CID | 167081658 |
| Molecular Formula | C16H12BrNS |
| Molecular Weight | 330.25 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 3-bromo-N,N-diphenylthiophen-2-amine |
| SMILES | Brc1ccsc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H12BrNS/c17-15-11-12-19-16(15)18(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H |
| InChIKey | NKGWPTQNHVFZSI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.25 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-N,N-diphenylthiophen-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N,N-diphenylthiophen-2-amine?
The IUPAC name of 3-bromo-N,N-diphenylthiophen-2-amine (CID 167081658) is 3-bromo-N,N-diphenylthiophen-2-amine.
What is the SMILES notation for 3-bromo-N,N-diphenylthiophen-2-amine?
The canonical SMILES for 3-bromo-N,N-diphenylthiophen-2-amine is Brc1ccsc1N(c1ccccc1)c1ccccc1.
What is the InChIKey of 3-bromo-N,N-diphenylthiophen-2-amine?
The InChIKey is NKGWPTQNHVFZSI-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12BrNS/c17-15-11-12-19-16(15)18(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H.
What are the key properties of 3-bromo-N,N-diphenylthiophen-2-amine?
3-bromo-N,N-diphenylthiophen-2-amine has a molecular weight of 330.25 g/mol, XLogP of 5.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N,N-diphenylthiophen-2-amine is sourced from PubChem (CID 167081658), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).