About 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline
3-butan-2-yl-2,5,6-trifluoro-4-methylaniline (PubChem CID 167081731) has the molecular formula C11H14F3N
and a molecular weight of 217.23 g/mol. Its IUPAC name is 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline.
Molecular Properties
| Compound Name | 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline |
| PubChem CID | 167081731 |
| Molecular Formula | C11H14F3N |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline |
| SMILES | CCC(C)c1c(C)c(F)c(F)c(N)c1F |
| InChI | InChI=1S/C11H14F3N/c1-4-5(2)7-6(3)8(12)10(14)11(15)9(7)13/h5H,4,15H2,1-3H3 |
| InChIKey | SWUICMWWDUOQTA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline?
The IUPAC name of 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline (CID 167081731) is 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline.
What is the SMILES notation for 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline?
The canonical SMILES for 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline is CCC(C)c1c(C)c(F)c(F)c(N)c1F.
What is the InChIKey of 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline?
The InChIKey is SWUICMWWDUOQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N/c1-4-5(2)7-6(3)8(12)10(14)11(15)9(7)13/h5H,4,15H2,1-3H3.
What are the key properties of 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline?
3-butan-2-yl-2,5,6-trifluoro-4-methylaniline has a molecular weight of 217.23 g/mol, XLogP of 3.51, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butan-2-yl-2,5,6-trifluoro-4-methylaniline is sourced from PubChem (CID 167081731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).