About 2,5-dichloro-6-ethyl-3,4-difluoroaniline
2,5-dichloro-6-ethyl-3,4-difluoroaniline (PubChem CID 167081785) has the molecular formula C8H7Cl2F2N
and a molecular weight of 226.05 g/mol. Its IUPAC name is 2,5-dichloro-6-ethyl-3,4-difluoroaniline.
Molecular Properties
| Compound Name | 2,5-dichloro-6-ethyl-3,4-difluoroaniline |
| PubChem CID | 167081785 |
| Molecular Formula | C8H7Cl2F2N |
| Molecular Weight | 226.05 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 2,5-dichloro-6-ethyl-3,4-difluoroaniline |
| SMILES | CCc1c(N)c(Cl)c(F)c(F)c1Cl |
| InChI | InChI=1S/C8H7Cl2F2N/c1-2-3-4(9)6(11)7(12)5(10)8(3)13/h2,13H2,1H3 |
| InChIKey | FANLUVFBZQZVEQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.05 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dichloro-6-ethyl-3,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dichloro-6-ethyl-3,4-difluoroaniline?
The IUPAC name of 2,5-dichloro-6-ethyl-3,4-difluoroaniline (CID 167081785) is 2,5-dichloro-6-ethyl-3,4-difluoroaniline.
What is the SMILES notation for 2,5-dichloro-6-ethyl-3,4-difluoroaniline?
The canonical SMILES for 2,5-dichloro-6-ethyl-3,4-difluoroaniline is CCc1c(N)c(Cl)c(F)c(F)c1Cl.
What is the InChIKey of 2,5-dichloro-6-ethyl-3,4-difluoroaniline?
The InChIKey is FANLUVFBZQZVEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2F2N/c1-2-3-4(9)6(11)7(12)5(10)8(3)13/h2,13H2,1H3.
What are the key properties of 2,5-dichloro-6-ethyl-3,4-difluoroaniline?
2,5-dichloro-6-ethyl-3,4-difluoroaniline has a molecular weight of 226.05 g/mol, XLogP of 3.42, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dichloro-6-ethyl-3,4-difluoroaniline is sourced from PubChem (CID 167081785), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).