C18H27F2N — CID 167081834
1-[(1S)-2,2-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexyl]piperidine (PubChem CID 167081834) has the molecular formula C18H27F2N and a molecular weight of 295.42 g/mol. Its IUPAC name is 1-[(1S)-2,2-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexyl]piperidine.
| Compound Name | 1-[(1S)-2,2-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexyl]piperidine |
|---|---|
| PubChem CID | 167081834 |
| Molecular Formula | C18H27F2N |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-[(1S)-2,2-difluoro-1-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]cyclohexyl]piperidine |
| SMILES | C=C(/C=C\C=C/C)[C@@]1(N2CCCCC2)CCCCC1(F)F |
| InChI | InChI=1S/C18H27F2N/c1-3-4-6-11-16(2)17(21-14-9-5-10-15-21)12-7-8-13-18(17,19)20/h3-4,6,11H,2,5,7-10,12-15H2,1H3/b4-3-,11-6-/t17-/m0/s1 |
| InChIKey | CJPAZVARFOUGGX-WLPCNANFSA-N |
| XLogP | 5.11 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|