C14H21NO — CID 167081853
(2S)-2-amino-2-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]cyclohexan-1-one (PubChem CID 167081853) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (2S)-2-amino-2-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]cyclohexan-1-one.
| Compound Name | (2S)-2-amino-2-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 167081853 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (2S)-2-amino-2-[(3Z,5Z)-3-methylhepta-1,3,5-trien-2-yl]cyclohexan-1-one |
| SMILES | C=C(/C(C)=C\C=C/C)[C@@]1(N)CCCCC1=O |
| InChI | InChI=1S/C14H21NO/c1-4-5-8-11(2)12(3)14(15)10-7-6-9-13(14)16/h4-5,8H,3,6-7,9-10,15H2,1-2H3/b5-4-,11-8-/t14-/m0/s1 |
| InChIKey | XJXJZPURVPFWQA-XTSHAYILSA-N |
| XLogP | 2.91 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|