C26H28ClN7O3 — CID 167081927
3-[2-(4-chloro-1-ethyl-2-methylbenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide (PubChem CID 167081927) has the molecular formula C26H28ClN7O3 and a molecular weight of 522.01 g/mol. Its IUPAC name is 3-[2-(4-chloro-1-ethyl-2-methylbenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide.
| Compound Name | 3-[2-(4-chloro-1-ethyl-2-methylbenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 167081927 |
| Molecular Formula | C26H28ClN7O3 |
| Molecular Weight | 522.01 g/mol |
| Exact Mass | 521.19 |
| IUPAC Name | 3-[2-(4-chloro-1-ethyl-2-methylbenzimidazol-5-yl)ethynyl]-1-[(3S,5E)-5-(methoxymethylidene)-1-prop-2-enoylpyrrolidin-3-yl]-5-(methylamino)pyrazole-4-carboxamide |
| SMILES | C=CC(=O)N1C[C@@H](n2nc(C#Cc3ccc4c(nc(C)n4CC)c3Cl)c(C(N)=O)c2NC)C/C1=C\OC |
| InChI | InChI=1S/C26H28ClN7O3/c1-6-21(35)33-13-17(12-18(33)14-37-5)34-26(29-4)22(25(28)36)19(31-34)10-8-16-9-11-20-24(23(16)27)30-15(3)32(20)7-2/h6,9,11,14,17,29H,1,7,12-13H2,2-5H3,(H2,28,36)/b18-14+/t17-/m0/s1 |
| InChIKey | RCZZDTOZKYJCFJ-AATZCTEQSA-N |
| XLogP | 3.20 |
| TPSA | 120.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.01 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|