C33H33FN4O — CID 167082855
N-(4-cyclopropyl-2-pyridinyl)-4-[(2Z,4E,6Z,8Z)-8-ethenyl-4-methyl-3-(5-methylpyrimidin-4-yl)deca-2,4,6,8-tetraenyl]-2-fluorobenzamide (PubChem CID 167082855) has the molecular formula C33H33FN4O and a molecular weight of 520.65 g/mol. Its IUPAC name is N-(4-cyclopropyl-2-pyridinyl)-4-[(2Z,4E,6Z,8Z)-8-ethenyl-4-methyl-3-(5-methylpyrimidin-4-yl)deca-2,4,6,8-tetraenyl]-2-fluorobenzamide.
| Compound Name | N-(4-cyclopropyl-2-pyridinyl)-4-[(2Z,4E,6Z,8Z)-8-ethenyl-4-methyl-3-(5-methylpyrimidin-4-yl)deca-2,4,6,8-tetraenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 167082855 |
| Molecular Formula | C33H33FN4O |
| Molecular Weight | 520.65 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | N-(4-cyclopropyl-2-pyridinyl)-4-[(2Z,4E,6Z,8Z)-8-ethenyl-4-methyl-3-(5-methylpyrimidin-4-yl)deca-2,4,6,8-tetraenyl]-2-fluorobenzamide |
| SMILES | C=CC(/C=C\C=C(C)\C(=C\Cc1ccc(C(=O)Nc2cc(C3CC3)ccn2)c(F)c1)c1ncncc1C)=C/C |
| InChI | InChI=1S/C33H33FN4O/c1-5-24(6-2)9-7-8-22(3)28(32-23(4)20-35-21-37-32)14-10-25-11-15-29(30(34)18-25)33(39)38-31-19-27(16-17-36-31)26-12-13-26/h5-9,11,14-21,26H,1,10,12-13H2,2-4H3,(H,36,38,39)/b9-7-,22-8+,24-6-,28-14- |
| InChIKey | FRQULZSVNOBNGQ-HPYNDLCZSA-N |
| XLogP | 7.71 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.65 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|