C17H26N2 — CID 167082954
N,2,7-trimethyl-4-[(2E,4Z)-1-methyliminohexa-2,4-dien-3-yl]cyclohept-2-en-1-imine (PubChem CID 167082954) has the molecular formula C17H26N2 and a molecular weight of 258.41 g/mol. Its IUPAC name is N,2,7-trimethyl-4-[(2E,4Z)-1-methyliminohexa-2,4-dien-3-yl]cyclohept-2-en-1-imine.
| Compound Name | N,2,7-trimethyl-4-[(2E,4Z)-1-methyliminohexa-2,4-dien-3-yl]cyclohept-2-en-1-imine |
|---|---|
| PubChem CID | 167082954 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | N,2,7-trimethyl-4-[(2E,4Z)-1-methyliminohexa-2,4-dien-3-yl]cyclohept-2-en-1-imine |
| SMILES | C/C=C\C(=C/C=N/C)C1C=C(C)/C(=N/C)C(C)CC1 |
| InChI | InChI=1S/C17H26N2/c1-6-7-15(10-11-18-4)16-9-8-13(2)17(19-5)14(3)12-16/h6-7,10-13,16H,8-9H2,1-5H3/b7-6-,15-10+,18-11+,19-17+ |
| InChIKey | BDMARWGRBYQOLF-FINPFHJRSA-N |
| XLogP | 4.25 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|