C18H22F3NO — CID 167082962
N-[(1E,3Z,5E,7Z)-5-ethyl-10,10,10-trifluoro-2-[(3E)-penta-1,3-dien-2-yl]deca-1,3,5,7-tetraenyl]formamide (PubChem CID 167082962) has the molecular formula C18H22F3NO and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[(1E,3Z,5E,7Z)-5-ethyl-10,10,10-trifluoro-2-[(3E)-penta-1,3-dien-2-yl]deca-1,3,5,7-tetraenyl]formamide.
| Compound Name | N-[(1E,3Z,5E,7Z)-5-ethyl-10,10,10-trifluoro-2-[(3E)-penta-1,3-dien-2-yl]deca-1,3,5,7-tetraenyl]formamide |
|---|---|
| PubChem CID | 167082962 |
| Molecular Formula | C18H22F3NO |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-[(1E,3Z,5E,7Z)-5-ethyl-10,10,10-trifluoro-2-[(3E)-penta-1,3-dien-2-yl]deca-1,3,5,7-tetraenyl]formamide |
| SMILES | C=C(/C=C/C)C(/C=C\C(=C\C=C/CC(F)(F)F)CC)=C/NC=O |
| InChI | InChI=1S/C18H22F3NO/c1-4-8-15(3)17(13-22-14-23)11-10-16(5-2)9-6-7-12-18(19,20)21/h4,6-11,13-14H,3,5,12H2,1-2H3,(H,22,23)/b7-6-,8-4+,11-10-,16-9+,17-13+ |
| InChIKey | BEJCIFQJBMVORI-CGAUEROPSA-N |
| XLogP | 5.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|