C28H33N5O3 — CID 167083038
1-[3-[2-amino-6-[(2-methoxy-4-pyridin-2-yloxycyclohexyl)methyl]quinazolin-8-yl]pyrrolidin-1-yl]prop-2-en-1-one (PubChem CID 167083038) has the molecular formula C28H33N5O3 and a molecular weight of 487.60 g/mol. Its IUPAC name is 1-[3-[2-amino-6-[(2-methoxy-4-pyridin-2-yloxycyclohexyl)methyl]quinazolin-8-yl]pyrrolidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[3-[2-amino-6-[(2-methoxy-4-pyridin-2-yloxycyclohexyl)methyl]quinazolin-8-yl]pyrrolidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 167083038 |
| Molecular Formula | C28H33N5O3 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 1-[3-[2-amino-6-[(2-methoxy-4-pyridin-2-yloxycyclohexyl)methyl]quinazolin-8-yl]pyrrolidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(c2cc(CC3CCC(Oc4ccccn4)CC3OC)cc3cnc(N)nc23)C1 |
| InChI | InChI=1S/C28H33N5O3/c1-3-26(34)33-11-9-20(17-33)23-14-18(13-21-16-31-28(29)32-27(21)23)12-19-7-8-22(15-24(19)35-2)36-25-6-4-5-10-30-25/h3-6,10,13-14,16,19-20,22,24H,1,7-9,11-12,15,17H2,2H3,(H2,29,31,32) |
| InChIKey | YHPXPHUOVJKZRW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 103.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|