C18H29FN2 — CID 167083150
(4E,6E,8E)-6-ethanimidoyl-4-fluoro-11-methyl-3-propyldodeca-4,6,8,10-tetraen-2-amine (PubChem CID 167083150) has the molecular formula C18H29FN2 and a molecular weight of 292.44 g/mol. Its IUPAC name is (4E,6E,8E)-6-ethanimidoyl-4-fluoro-11-methyl-3-propyldodeca-4,6,8,10-tetraen-2-amine.
| Compound Name | (4E,6E,8E)-6-ethanimidoyl-4-fluoro-11-methyl-3-propyldodeca-4,6,8,10-tetraen-2-amine |
|---|---|
| PubChem CID | 167083150 |
| Molecular Formula | C18H29FN2 |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | (4E,6E,8E)-6-ethanimidoyl-4-fluoro-11-methyl-3-propyldodeca-4,6,8,10-tetraen-2-amine |
| SMILES | [H]/N=C(C)\C(=C\C=C\C=C(C)C)\C=C(\F)C(CCC)C(C)N |
| InChI | InChI=1S/C18H29FN2/c1-6-9-17(15(5)21)18(19)12-16(14(4)20)11-8-7-10-13(2)3/h7-8,10-12,15,17,20H,6,9,21H2,1-5H3/b8-7+,16-11+,18-12+,20-14- |
| InChIKey | QXVXMRXPUIPLRU-QDXDFOQTSA-N |
| XLogP | 5.09 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|