About (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium
(4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium (PubChem CID 167083277) has the molecular formula C11H20NO+
and a molecular weight of 182.29 g/mol. Its IUPAC name is (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium.
Molecular Properties
| Compound Name | (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium |
| PubChem CID | 167083277 |
| Molecular Formula | C11H20NO+ |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium |
| SMILES | COC1=CCC(C[N+](C)(C)C)C=C1 |
| InChI | InChI=1S/C11H20NO/c1-12(2,3)9-10-5-7-11(13-4)8-6-10/h5,7-8,10H,6,9H2,1-4H3/q+1 |
| InChIKey | PIQDHHLEQNXXOQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium?
The IUPAC name of (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium (CID 167083277) is (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium.
What is the SMILES notation for (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium?
The canonical SMILES for (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium is COC1=CCC(C[N+](C)(C)C)C=C1.
What is the InChIKey of (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium?
The InChIKey is PIQDHHLEQNXXOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20NO/c1-12(2,3)9-10-5-7-11(13-4)8-6-10/h5,7-8,10H,6,9H2,1-4H3/q+1.
What are the key properties of (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium?
(4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium has a molecular weight of 182.29 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxycyclohexa-2,4-dien-1-yl)methyl-trimethylazanium is sourced from PubChem (CID 167083277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).