About 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine
1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine (PubChem CID 167083420) has the molecular formula C30H32N2O2
and a molecular weight of 452.60 g/mol. Its IUPAC name is 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine.
Molecular Properties
| Compound Name | 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine |
| PubChem CID | 167083420 |
| Molecular Formula | C30H32N2O2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine |
| SMILES | CNC(N)(c1ccc(Oc2ccc(C)c(C)c2)cc1)c1ccc(Oc2ccc(C)c(C)c2)cc1 |
| InChI | InChI=1S/C30H32N2O2/c1-20-6-12-28(18-22(20)3)33-26-14-8-24(9-15-26)30(31,32-5)25-10-16-27(17-11-25)34-29-13-7-21(2)23(4)19-29/h6-19,32H,31H2,1-5H3 |
| InChIKey | WSHSSCNHMDGGFS-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine?
The IUPAC name of 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine (CID 167083420) is 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine.
What is the SMILES notation for 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine?
The canonical SMILES for 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine is CNC(N)(c1ccc(Oc2ccc(C)c(C)c2)cc1)c1ccc(Oc2ccc(C)c(C)c2)cc1.
What is the InChIKey of 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine?
The InChIKey is WSHSSCNHMDGGFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H32N2O2/c1-20-6-12-28(18-22(20)3)33-26-14-8-24(9-15-26)30(31,32-5)25-10-16-27(17-11-25)34-29-13-7-21(2)23(4)19-29/h6-19,32H,31H2,1-5H3.
What are the key properties of 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine?
1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine has a molecular weight of 452.60 g/mol, XLogP of 6.88, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis[4-(3,4-dimethylphenoxy)phenyl]-N'-methylmethanediamine is sourced from PubChem (CID 167083420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).