C19H31N3O2S — CID 167083678
1-[(2E,4E)-5-tert-butylsulfinamoylhexa-2,4-dien-3-yl]-3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]urea (PubChem CID 167083678) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is 1-[(2E,4E)-5-tert-butylsulfinamoylhexa-2,4-dien-3-yl]-3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]urea.
| Compound Name | 1-[(2E,4E)-5-tert-butylsulfinamoylhexa-2,4-dien-3-yl]-3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]urea |
|---|---|
| PubChem CID | 167083678 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 1-[(2E,4E)-5-tert-butylsulfinamoylhexa-2,4-dien-3-yl]-3-[(2E,4Z)-2-ethenylhexa-2,4-dienyl]urea |
| SMILES | C=C/C(=C\C=C/C)CNC(=O)NC(=C/C)/C=C(\C)S(=O)NC(C)(C)C |
| InChI | InChI=1S/C19H31N3O2S/c1-8-11-12-16(9-2)14-20-18(23)21-17(10-3)13-15(4)25(24)22-19(5,6)7/h8-13,22H,2,14H2,1,3-7H3,(H2,20,21,23)/b11-8-,15-13+,16-12+,17-10+ |
| InChIKey | CWRAJNIEAFSFFM-DDGCSECTSA-N |
| XLogP | 3.83 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|