C30H41N5O4S2 — CID 167083709
propan-2-yl N-[4-[5-[4-[(benzylamino)oxyamino]-2-tert-butylsulfinamoylphenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate (PubChem CID 167083709) has the molecular formula C30H41N5O4S2 and a molecular weight of 599.82 g/mol. Its IUPAC name is propan-2-yl N-[4-[5-[4-[(benzylamino)oxyamino]-2-tert-butylsulfinamoylphenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate.
| Compound Name | propan-2-yl N-[4-[5-[4-[(benzylamino)oxyamino]-2-tert-butylsulfinamoylphenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 167083709 |
| Molecular Formula | C30H41N5O4S2 |
| Molecular Weight | 599.82 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | propan-2-yl N-[4-[5-[4-[(benzylamino)oxyamino]-2-tert-butylsulfinamoylphenyl]-1,3-thiazol-2-yl]cyclohexyl]carbamate |
| SMILES | CC(C)OC(=O)NC1CCC(c2ncc(-c3ccc(NONCc4ccccc4)cc3S(=O)NC(C)(C)C)s2)CC1 |
| InChI | InChI=1S/C30H41N5O4S2/c1-20(2)38-29(36)33-23-13-11-22(12-14-23)28-31-19-26(40-28)25-16-15-24(17-27(25)41(37)35-30(3,4)5)34-39-32-18-21-9-7-6-8-10-21/h6-10,15-17,19-20,22-23,32,34-35H,11-14,18H2,1-5H3,(H,33,36) |
| InChIKey | NLMWBHMUCQSKQM-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 113.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.82 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|