C16H28FNO — CID 167084122
(Z)-4-[[(2E,7Z)-9-fluoro-2,3-dimethylnona-2,7-dienyl]-methylamino]but-2-en-1-ol (PubChem CID 167084122) has the molecular formula C16H28FNO and a molecular weight of 269.40 g/mol. Its IUPAC name is (Z)-4-[[(2E,7Z)-9-fluoro-2,3-dimethylnona-2,7-dienyl]-methylamino]but-2-en-1-ol.
| Compound Name | (Z)-4-[[(2E,7Z)-9-fluoro-2,3-dimethylnona-2,7-dienyl]-methylamino]but-2-en-1-ol |
|---|---|
| PubChem CID | 167084122 |
| Molecular Formula | C16H28FNO |
| Molecular Weight | 269.40 g/mol |
| Exact Mass | 269.22 |
| IUPAC Name | (Z)-4-[[(2E,7Z)-9-fluoro-2,3-dimethylnona-2,7-dienyl]-methylamino]but-2-en-1-ol |
| SMILES | C/C(CCC/C=C\CF)=C(/C)CN(C)C/C=C\CO |
| InChI | InChI=1S/C16H28FNO/c1-15(10-6-4-5-7-11-17)16(2)14-18(3)12-8-9-13-19/h5,7-9,19H,4,6,10-14H2,1-3H3/b7-5-,9-8-,16-15+ |
| InChIKey | KIZFYLKUAZBGAL-WAPFNMAESA-N |
| XLogP | 3.50 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.40 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|