C11H20FN — CID 167084262
(2Z,5Z)-7-fluoro-N,2,3,4-tetramethylhepta-2,5-dien-1-amine (PubChem CID 167084262) has the molecular formula C11H20FN and a molecular weight of 185.29 g/mol. Its IUPAC name is (2Z,5Z)-7-fluoro-N,2,3,4-tetramethylhepta-2,5-dien-1-amine.
| Compound Name | (2Z,5Z)-7-fluoro-N,2,3,4-tetramethylhepta-2,5-dien-1-amine |
|---|---|
| PubChem CID | 167084262 |
| Molecular Formula | C11H20FN |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.16 |
| IUPAC Name | (2Z,5Z)-7-fluoro-N,2,3,4-tetramethylhepta-2,5-dien-1-amine |
| SMILES | CNC/C(C)=C(/C)C(C)/C=C\CF |
| InChI | InChI=1S/C11H20FN/c1-9(6-5-7-12)11(3)10(2)8-13-4/h5-6,9,13H,7-8H2,1-4H3/b6-5-,11-10- |
| InChIKey | HXKOBPDPFOLTME-VIFBMRGNSA-N |
| XLogP | 2.70 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|