C15H23F2NO — CID 167084268
(2Z,5Z,9Z)-1,11-difluoro-5,8-dimethyl-6-(methylaminomethyl)undeca-2,5,9-trien-4-one (PubChem CID 167084268) has the molecular formula C15H23F2NO and a molecular weight of 271.35 g/mol. Its IUPAC name is (2Z,5Z,9Z)-1,11-difluoro-5,8-dimethyl-6-(methylaminomethyl)undeca-2,5,9-trien-4-one.
| Compound Name | (2Z,5Z,9Z)-1,11-difluoro-5,8-dimethyl-6-(methylaminomethyl)undeca-2,5,9-trien-4-one |
|---|---|
| PubChem CID | 167084268 |
| Molecular Formula | C15H23F2NO |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (2Z,5Z,9Z)-1,11-difluoro-5,8-dimethyl-6-(methylaminomethyl)undeca-2,5,9-trien-4-one |
| SMILES | CNC/C(CC(C)/C=C\CF)=C(/C)C(=O)/C=C\CF |
| InChI | InChI=1S/C15H23F2NO/c1-12(6-4-8-16)10-14(11-18-3)13(2)15(19)7-5-9-17/h4-7,12,18H,8-11H2,1-3H3/b6-4-,7-5-,14-13- |
| InChIKey | STDXDYGBKHSNOG-YELIAWABSA-N |
| XLogP | 3.17 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|