C21H17NO — CID 167084450
12,15-dimethyl-5-phenyl-4-oxa-6-azatetracyclo[7.5.1.03,7.012,15]pentadeca-1,3(7),5,8,10,13-hexaene (PubChem CID 167084450) has the molecular formula C21H17NO and a molecular weight of 299.37 g/mol. Its IUPAC name is 12,15-dimethyl-5-phenyl-4-oxa-6-azatetracyclo[7.5.1.03,7.012,15]pentadeca-1,3(7),5,8,10,13-hexaene.
| Compound Name | 12,15-dimethyl-5-phenyl-4-oxa-6-azatetracyclo[7.5.1.03,7.012,15]pentadeca-1,3(7),5,8,10,13-hexaene |
|---|---|
| PubChem CID | 167084450 |
| Molecular Formula | C21H17NO |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 12,15-dimethyl-5-phenyl-4-oxa-6-azatetracyclo[7.5.1.03,7.012,15]pentadeca-1,3(7),5,8,10,13-hexaene |
| SMILES | CC12C=CC3=Cc4nc(-c5ccccc5)oc4C=C(C=C1)C32C |
| InChI | InChI=1S/C21H17NO/c1-20-10-8-15-12-17-18(13-16(9-11-20)21(15,20)2)23-19(22-17)14-6-4-3-5-7-14/h3-13H,1-2H3 |
| InChIKey | UJYJKQAJPMXYGZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |