C21H25N5O5 — CID 167084987
N-[4-(1-aminoethenyl)-2-nitrophenyl]-N'-[4-(1-methoxyethenyl)-2-nitrophenyl]butane-1,4-diamine (PubChem CID 167084987) has the molecular formula C21H25N5O5 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-[4-(1-aminoethenyl)-2-nitrophenyl]-N'-[4-(1-methoxyethenyl)-2-nitrophenyl]butane-1,4-diamine.
| Compound Name | N-[4-(1-aminoethenyl)-2-nitrophenyl]-N'-[4-(1-methoxyethenyl)-2-nitrophenyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 167084987 |
| Molecular Formula | C21H25N5O5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[4-(1-aminoethenyl)-2-nitrophenyl]-N'-[4-(1-methoxyethenyl)-2-nitrophenyl]butane-1,4-diamine |
| SMILES | C=C(N)c1ccc(NCCCCNc2ccc(C(=C)OC)cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H25N5O5/c1-14(22)16-6-8-18(20(12-16)25(27)28)23-10-4-5-11-24-19-9-7-17(15(2)31-3)13-21(19)26(29)30/h6-9,12-13,23-24H,1-2,4-5,10-11,22H2,3H3 |
| InChIKey | YMAWVHIFZNFHJN-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 145.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|