C17H21N2O4+ — CID 167085684
(1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-[2-(1,3-oxazol-2-yl)phenyl]acetate (PubChem CID 167085684) has the molecular formula C17H21N2O4+ and a molecular weight of 317.37 g/mol. Its IUPAC name is (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-[2-(1,3-oxazol-2-yl)phenyl]acetate.
| Compound Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-[2-(1,3-oxazol-2-yl)phenyl]acetate |
|---|---|
| PubChem CID | 167085684 |
| Molecular Formula | C17H21N2O4+ |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | (1,1-dimethylpyrrolidin-1-ium-3-yl) 2-hydroxy-2-[2-(1,3-oxazol-2-yl)phenyl]acetate |
| SMILES | C[N+]1(C)CCC(OC(=O)C(O)c2ccccc2-c2ncco2)C1 |
| InChI | InChI=1S/C17H21N2O4/c1-19(2)9-7-12(11-19)23-17(21)15(20)13-5-3-4-6-14(13)16-18-8-10-22-16/h3-6,8,10,12,15,20H,7,9,11H2,1-2H3/q+1 |
| InChIKey | XBXXWYUJDPDVMT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 72.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|