About N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine
N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine (PubChem CID 167086019) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine.
Molecular Properties
| Compound Name | N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine |
| PubChem CID | 167086019 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine |
| SMILES | [H]/N=C/C=N/C/C(=C\C)C(C)C |
| InChI | InChI=1S/C9H16N2/c1-4-9(8(2)3)7-11-6-5-10/h4-6,8,10H,7H2,1-3H3/b9-4+,10-5+,11-6+ |
| InChIKey | APOFUTYUPLTHSD-RYRBNAPQSA-N |
| XLogP | 2.31 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine?
The IUPAC name of N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine (CID 167086019) is N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine.
What is the SMILES notation for N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine?
The canonical SMILES for N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine is [H]/N=C/C=N/C/C(=C\C)C(C)C.
What is the InChIKey of N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine?
The InChIKey is APOFUTYUPLTHSD-RYRBNAPQSA-N. The full InChI is InChI=1S/C9H16N2/c1-4-9(8(2)3)7-11-6-5-10/h4-6,8,10H,7H2,1-3H3/b9-4+,10-5+,11-6+.
What are the key properties of N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine?
N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine has a molecular weight of 152.24 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(Z)-2-propan-2-ylbut-2-enyl]ethane-1,2-diimine is sourced from PubChem (CID 167086019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).