About methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate
methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate (PubChem CID 167086156) has the molecular formula C16H18Cl2N2O5
and a molecular weight of 389.24 g/mol. Its IUPAC name is methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate.
Molecular Properties
| Compound Name | methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate |
| PubChem CID | 167086156 |
| Molecular Formula | C16H18Cl2N2O5 |
| Molecular Weight | 389.24 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate |
| SMILES | COC(=O)CC(C)NC(=O)C1(C(=O)Nc2cc(Cl)cc(Cl)c2)CCO1 |
| InChI | InChI=1S/C16H18Cl2N2O5/c1-9(5-13(21)24-2)19-14(22)16(3-4-25-16)15(23)20-12-7-10(17)6-11(18)8-12/h6-9H,3-5H2,1-2H3,(H,19,22)(H,20,23) |
| InChIKey | RQGNRKJXYJCDEO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate?
The IUPAC name of methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate (CID 167086156) is methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate.
What is the SMILES notation for methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate?
The canonical SMILES for methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate is COC(=O)CC(C)NC(=O)C1(C(=O)Nc2cc(Cl)cc(Cl)c2)CCO1.
What is the InChIKey of methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate?
The InChIKey is RQGNRKJXYJCDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18Cl2N2O5/c1-9(5-13(21)24-2)19-14(22)16(3-4-25-16)15(23)20-12-7-10(17)6-11(18)8-12/h6-9H,3-5H2,1-2H3,(H,19,22)(H,20,23).
What are the key properties of methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate?
methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate has a molecular weight of 389.24 g/mol, XLogP of 2.16, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[[2-[(3,5-dichlorophenyl)carbamoyl]oxetane-2-carbonyl]amino]butanoate is sourced from PubChem (CID 167086156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).