C45H48N2O13S — CID 167087265
[5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] 4-[3-[[4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenoxy]carbonylamino]-2-methylanilino]-4-oxobutanoate (PubChem CID 167087265) has the molecular formula C45H48N2O13S and a molecular weight of 856.95 g/mol. Its IUPAC name is [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] 4-[3-[[4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenoxy]carbonylamino]-2-methylanilino]-4-oxobutanoate.
| Compound Name | [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] 4-[3-[[4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenoxy]carbonylamino]-2-methylanilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 167087265 |
| Molecular Formula | C45H48N2O13S |
| Molecular Weight | 856.95 g/mol |
| Exact Mass | 856.29 |
| IUPAC Name | [5-oxo-2,2-bis(prop-2-enoyloxymethyl)hept-6-enyl] 4-[3-[[4-(4-hydroxy-3-prop-2-enylphenyl)sulfonyl-2-prop-2-enylphenoxy]carbonylamino]-2-methylanilino]-4-oxobutanoate |
| SMILES | C=CCc1cc(S(=O)(=O)c2ccc(OC(=O)Nc3cccc(NC(=O)CCC(=O)OCC(CCC(=O)C=C)(COC(=O)C=C)COC(=O)C=C)c3C)c(CC=C)c2)ccc1O |
| InChI | InChI=1S/C45H48N2O13S/c1-7-13-31-25-34(17-19-38(31)49)61(55,56)35-18-20-39(32(26-35)14-8-2)60-44(54)47-37-16-12-15-36(30(37)6)46-40(50)21-22-43(53)59-29-45(24-23-33(48)9-3,27-57-41(51)10-4)28-58-42(52)11-5/h7-12,15-20,25-26,49H,1-5,13-14,21-24,27-29H2,6H3,(H,46,50)(H,47,54) |
| InChIKey | WHEIKZFWDFGDTF-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 217.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.95 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|