C14H26N2O2 — CID 167088009
(E,3S)-10-amino-10-methyl-3-(methylamino)dodec-5-ene-2,11-dione (PubChem CID 167088009) has the molecular formula C14H26N2O2 and a molecular weight of 254.37 g/mol. Its IUPAC name is (E,3S)-10-amino-10-methyl-3-(methylamino)dodec-5-ene-2,11-dione.
| Compound Name | (E,3S)-10-amino-10-methyl-3-(methylamino)dodec-5-ene-2,11-dione |
|---|---|
| PubChem CID | 167088009 |
| Molecular Formula | C14H26N2O2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | (E,3S)-10-amino-10-methyl-3-(methylamino)dodec-5-ene-2,11-dione |
| SMILES | CN[C@@H](C/C=C/CCCC(C)(N)C(C)=O)C(C)=O |
| InChI | InChI=1S/C14H26N2O2/c1-11(17)13(16-4)9-7-5-6-8-10-14(3,15)12(2)18/h5,7,13,16H,6,8-10,15H2,1-4H3/b7-5+/t13-,14?/m0/s1 |
| InChIKey | LHZTVVRKJHIFKZ-CSIDKBJMSA-N |
| XLogP | 1.59 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|