C7H12ClNO2 — CID 167088658
trans-(1Z,1R,2R)-N,2-dihydroxy-2-methylcyclopentane-1-carboximidoyl chloride (PubChem CID 167088658) has the molecular formula C7H12ClNO2 and a molecular weight of 177.63 g/mol. Its IUPAC name is trans-(1Z,1R,2R)-N,2-dihydroxy-2-methylcyclopentane-1-carboximidoyl chloride.
| Compound Name | trans-(1Z,1R,2R)-N,2-dihydroxy-2-methylcyclopentane-1-carboximidoyl chloride |
|---|---|
| PubChem CID | 167088658 |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | trans-(1Z,1R,2R)-N,2-dihydroxy-2-methylcyclopentane-1-carboximidoyl chloride |
| SMILES | C[C@@]1(O)CCC[C@H]1/C(Cl)=N/O |
| InChI | InChI=1S/C7H12ClNO2/c1-7(10)4-2-3-5(7)6(8)9-11/h5,10-11H,2-4H2,1H3/b9-6-/t5-,7+/m0/s1 |
| InChIKey | FPMFCWHAJFRYKJ-AVVLFYFJSA-N |
| XLogP | 1.56 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|