C34H49FN6O2 — CID 167088924
tert-butyl 9-[5-[(3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,6,7,9-hexahydropyrido[3,4-b]indol-1-yl]pyrimidin-2-yl]-3,9-diazaspiro[5.5]undecane-3-carboxylate (PubChem CID 167088924) has the molecular formula C34H49FN6O2 and a molecular weight of 592.80 g/mol. Its IUPAC name is tert-butyl 9-[5-[(3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,6,7,9-hexahydropyrido[3,4-b]indol-1-yl]pyrimidin-2-yl]-3,9-diazaspiro[5.5]undecane-3-carboxylate.
| Compound Name | tert-butyl 9-[5-[(3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,6,7,9-hexahydropyrido[3,4-b]indol-1-yl]pyrimidin-2-yl]-3,9-diazaspiro[5.5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 167088924 |
| Molecular Formula | C34H49FN6O2 |
| Molecular Weight | 592.80 g/mol |
| Exact Mass | 592.39 |
| IUPAC Name | tert-butyl 9-[5-[(3R)-2-(2-fluoro-2-methylpropyl)-3-methyl-1,3,4,6,7,9-hexahydropyrido[3,4-b]indol-1-yl]pyrimidin-2-yl]-3,9-diazaspiro[5.5]undecane-3-carboxylate |
| SMILES | C[C@@H]1Cc2c([nH]c3c2=CCCC=3)C(c2cnc(N3CCC4(CCN(C(=O)OC(C)(C)C)CC4)CC3)nc2)N1CC(C)(C)F |
| InChI | InChI=1S/C34H49FN6O2/c1-23-19-26-25-9-7-8-10-27(25)38-28(26)29(41(23)22-33(5,6)35)24-20-36-30(37-21-24)39-15-11-34(12-16-39)13-17-40(18-14-34)31(42)43-32(2,3)4/h9-10,20-21,23,29,38H,7-8,11-19,22H2,1-6H3/t23-,29?/m1/s1 |
| InChIKey | SCWQLCRWPORUCL-WIZGVZBGSA-N |
| XLogP | 4.86 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.80 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |