C14H23N3 — CID 167089079
5,8,8,11-tetramethyl-11,12,13-triazatricyclo[8.3.0.04,6]trideca-1(10),12-diene (PubChem CID 167089079) has the molecular formula C14H23N3 and a molecular weight of 233.36 g/mol. Its IUPAC name is 5,8,8,11-tetramethyl-11,12,13-triazatricyclo[8.3.0.04,6]trideca-1(10),12-diene.
| Compound Name | 5,8,8,11-tetramethyl-11,12,13-triazatricyclo[8.3.0.04,6]trideca-1(10),12-diene |
|---|---|
| PubChem CID | 167089079 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 5,8,8,11-tetramethyl-11,12,13-triazatricyclo[8.3.0.04,6]trideca-1(10),12-diene |
| SMILES | CC1C2CCc3nnn(C)c3CC(C)(C)CC12 |
| InChI | InChI=1S/C14H23N3/c1-9-10-5-6-12-13(17(4)16-15-12)8-14(2,3)7-11(9)10/h9-11H,5-8H2,1-4H3 |
| InChIKey | BEVYBRBWRWOTQG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |