About 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine
2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine (PubChem CID 167089672) has the molecular formula C9H19NO2
and a molecular weight of 173.26 g/mol. Its IUPAC name is 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine.
Molecular Properties
| Compound Name | 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine |
| PubChem CID | 167089672 |
| Molecular Formula | C9H19NO2 |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.14 |
| IUPAC Name | 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine |
| SMILES | CC(C)OCC1CN(C)C(C)O1 |
| InChI | InChI=1S/C9H19NO2/c1-7(2)11-6-9-5-10(4)8(3)12-9/h7-9H,5-6H2,1-4H3 |
| InChIKey | DPLPRQMNUGNWTC-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine?
The IUPAC name of 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine (CID 167089672) is 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine.
What is the SMILES notation for 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine?
The canonical SMILES for 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine is CC(C)OCC1CN(C)C(C)O1.
What is the InChIKey of 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine?
The InChIKey is DPLPRQMNUGNWTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO2/c1-7(2)11-6-9-5-10(4)8(3)12-9/h7-9H,5-6H2,1-4H3.
What are the key properties of 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine?
2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine has a molecular weight of 173.26 g/mol, XLogP of 1.09, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-5-(propan-2-yloxymethyl)-1,3-oxazolidine is sourced from PubChem (CID 167089672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).