C16H12GeS16 — CID 16708972
5,5'-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-2,2'-spirobi[[1,3]dithiolo[4,5-d][1,3,2]dithiagermole] (PubChem CID 16708972) has the molecular formula C16H12GeS16 and a molecular weight of 789.95 g/mol. Its IUPAC name is 5,5'-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-2,2'-spirobi[[1,3]dithiolo[4,5-d][1,3,2]dithiagermole].
| Compound Name | 5,5'-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-2,2'-spirobi[[1,3]dithiolo[4,5-d][1,3,2]dithiagermole] |
|---|---|
| PubChem CID | 16708972 |
| Molecular Formula | C16H12GeS16 |
| Molecular Weight | 789.95 g/mol |
| Exact Mass | 789.57 |
| IUPAC Name | 5,5'-bis[4,5-bis(methylsulfanyl)-1,3-dithiol-2-ylidene]-2,2'-spirobi[[1,3]dithiolo[4,5-d][1,3,2]dithiagermole] |
| SMILES | CSC1=C(SC)SC(=C2SC3=C(S2)S[Ge]2(S3)SC3=C(SC(=C4SC(SC)=C(SC)S4)S3)S2)S1 |
| InChI | InChI=1S/C16H12GeS16/c1-18-5-6(19-2)23-9(22-5)11-26-13-14(27-11)31-17(30-13)32-15-16(33-17)29-12(28-15)10-24-7(20-3)8(21-4)25-10/h1-4H3 |
| InChIKey | IWMDZRGAGQQRGV-UHFFFAOYSA-N |
| XLogP | 12.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.95 |
| LogP ≤ 5 | 12.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |