C22H25FN4O4S — CID 167089961
4-[[5-ethynyl-4-(2-hydroxycyclohexyl)oxypyrimidin-2-yl]amino]-N-(3-fluorocyclobutyl)benzenesulfonamide (PubChem CID 167089961) has the molecular formula C22H25FN4O4S and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-[[5-ethynyl-4-(2-hydroxycyclohexyl)oxypyrimidin-2-yl]amino]-N-(3-fluorocyclobutyl)benzenesulfonamide.
| Compound Name | 4-[[5-ethynyl-4-(2-hydroxycyclohexyl)oxypyrimidin-2-yl]amino]-N-(3-fluorocyclobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 167089961 |
| Molecular Formula | C22H25FN4O4S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.16 |
| IUPAC Name | 4-[[5-ethynyl-4-(2-hydroxycyclohexyl)oxypyrimidin-2-yl]amino]-N-(3-fluorocyclobutyl)benzenesulfonamide |
| SMILES | C#Cc1cnc(Nc2ccc(S(=O)(=O)NC3CC(F)C3)cc2)nc1OC1CCCCC1O |
| InChI | InChI=1S/C22H25FN4O4S/c1-2-14-13-24-22(26-21(14)31-20-6-4-3-5-19(20)28)25-16-7-9-18(10-8-16)32(29,30)27-17-11-15(23)12-17/h1,7-10,13,15,17,19-20,27-28H,3-6,11-12H2,(H,24,25,26) |
| InChIKey | GGCFOHFYWZRUNX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|