About (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine
(E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine (PubChem CID 167090440) has the molecular formula C20H20FN5
and a molecular weight of 349.41 g/mol. Its IUPAC name is (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine.
Molecular Properties
| Compound Name | (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine |
| PubChem CID | 167090440 |
| Molecular Formula | C20H20FN5 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine |
| SMILES | Cc1ccc(CN/C(=C/N)c2cc(-c3ccc(F)cc3)ccc2N)nn1 |
| InChI | InChI=1S/C20H20FN5/c1-13-2-8-17(26-25-13)12-24-20(11-22)18-10-15(5-9-19(18)23)14-3-6-16(21)7-4-14/h2-11,24H,12,22-23H2,1H3/b20-11+ |
| InChIKey | ODFCIOMXULWJJA-RGVLZGJSSA-N |
| XLogP | 3.22 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine?
The IUPAC name of (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine (CID 167090440) is (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine.
What is the SMILES notation for (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine?
The canonical SMILES for (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine is Cc1ccc(CN/C(=C/N)c2cc(-c3ccc(F)cc3)ccc2N)nn1.
What is the InChIKey of (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine?
The InChIKey is ODFCIOMXULWJJA-RGVLZGJSSA-N. The full InChI is InChI=1S/C20H20FN5/c1-13-2-8-17(26-25-13)12-24-20(11-22)18-10-15(5-9-19(18)23)14-3-6-16(21)7-4-14/h2-11,24H,12,22-23H2,1H3/b20-11+.
What are the key properties of (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine?
(E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine has a molecular weight of 349.41 g/mol, XLogP of 3.22, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-[2-amino-5-(4-fluorophenyl)phenyl]-N-[(6-methylpyridazin-3-yl)methyl]ethene-1,2-diamine is sourced from PubChem (CID 167090440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).