C27H27N3O — CID 167090949
9-[(4-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide (PubChem CID 167090949) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is 9-[(4-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide.
| Compound Name | 9-[(4-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
|---|---|
| PubChem CID | 167090949 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 9-[(4-methylphenyl)methyl]-N-(pyridin-3-ylmethyl)-1,2,3,4-tetrahydrocarbazole-4-carboxamide |
| SMILES | Cc1ccc(Cn2c3c(c4ccccc42)C(C(=O)NCc2cccnc2)CCC3)cc1 |
| InChI | InChI=1S/C27H27N3O/c1-19-11-13-20(14-12-19)18-30-24-9-3-2-7-22(24)26-23(8-4-10-25(26)30)27(31)29-17-21-6-5-15-28-16-21/h2-3,5-7,9,11-16,23H,4,8,10,17-18H2,1H3,(H,29,31) |
| InChIKey | DDDQDBPLDVGQIS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|