About 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol
4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol (PubChem CID 167091008) has the molecular formula C16H34O4
and a molecular weight of 290.44 g/mol. Its IUPAC name is 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol.
Molecular Properties
| Compound Name | 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol |
| PubChem CID | 167091008 |
| Molecular Formula | C16H34O4 |
| Molecular Weight | 290.44 g/mol |
| Exact Mass | 290.25 |
| IUPAC Name | 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol |
| SMILES | CCC(C)(CC(O)COC)C(C)(C)OCCC(C)(C)O |
| InChI | InChI=1S/C16H34O4/c1-8-16(6,11-13(17)12-19-7)15(4,5)20-10-9-14(2,3)18/h13,17-18H,8-12H2,1-7H3 |
| InChIKey | YETJHXJFHJWGHK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.44 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol?
The IUPAC name of 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol (CID 167091008) is 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol.
What is the SMILES notation for 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol?
The canonical SMILES for 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol is CCC(C)(CC(O)COC)C(C)(C)OCCC(C)(C)O.
What is the InChIKey of 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol?
The InChIKey is YETJHXJFHJWGHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O4/c1-8-16(6,11-13(17)12-19-7)15(4,5)20-10-9-14(2,3)18/h13,17-18H,8-12H2,1-7H3.
What are the key properties of 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol?
4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol has a molecular weight of 290.44 g/mol, XLogP of 2.76, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-(3-hydroxy-3-methylbutoxy)-1-methoxy-4,5-dimethylhexan-2-ol is sourced from PubChem (CID 167091008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).