C17H20N2O5S — CID 167091252
6-methyl-6-propan-2-yl-2-(1,1,3-trioxothiazinan-6-yl)cyclohepta[c]pyrrole-1,3-dione (PubChem CID 167091252) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is 6-methyl-6-propan-2-yl-2-(1,1,3-trioxothiazinan-6-yl)cyclohepta[c]pyrrole-1,3-dione.
| Compound Name | 6-methyl-6-propan-2-yl-2-(1,1,3-trioxothiazinan-6-yl)cyclohepta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 167091252 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 6-methyl-6-propan-2-yl-2-(1,1,3-trioxothiazinan-6-yl)cyclohepta[c]pyrrole-1,3-dione |
| SMILES | CC(C)C1(C)C=CC2=C(C=C1)C(=O)N(C1CCC(=O)NS1(=O)=O)C2=O |
| InChI | InChI=1S/C17H20N2O5S/c1-10(2)17(3)8-6-11-12(7-9-17)16(22)19(15(11)21)14-5-4-13(20)18-25(14,23)24/h6-10,14H,4-5H2,1-3H3,(H,18,20) |
| InChIKey | DLFXUAMBVGLURX-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|