C13H24N2O2 — CID 167091632
1-(4-butan-2-ylpiperazin-1-yl)-4-hydroxy-2-methylidenebutan-1-one (PubChem CID 167091632) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 1-(4-butan-2-ylpiperazin-1-yl)-4-hydroxy-2-methylidenebutan-1-one.
| Compound Name | 1-(4-butan-2-ylpiperazin-1-yl)-4-hydroxy-2-methylidenebutan-1-one |
|---|---|
| PubChem CID | 167091632 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 1-(4-butan-2-ylpiperazin-1-yl)-4-hydroxy-2-methylidenebutan-1-one |
| SMILES | C=C(CCO)C(=O)N1CCN(C(C)CC)CC1 |
| InChI | InChI=1S/C13H24N2O2/c1-4-12(3)14-6-8-15(9-7-14)13(17)11(2)5-10-16/h12,16H,2,4-10H2,1,3H3 |
| InChIKey | PFWSXHDIHWUPMZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|