About 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine
5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine (PubChem CID 167091870) has the molecular formula C12H17BrN2O
and a molecular weight of 285.19 g/mol. Its IUPAC name is 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine.
Molecular Properties
| Compound Name | 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine |
| PubChem CID | 167091870 |
| Molecular Formula | C12H17BrN2O |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.05 |
| IUPAC Name | 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine |
| SMILES | CC(C)C1NOC(c2cccc(Br)c2)N1C |
| InChI | InChI=1S/C12H17BrN2O/c1-8(2)11-14-16-12(15(11)3)9-5-4-6-10(13)7-9/h4-8,11-12,14H,1-3H3 |
| InChIKey | NLQMVIMFCUZKGB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine?
The IUPAC name of 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine (CID 167091870) is 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine.
What is the SMILES notation for 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine?
The canonical SMILES for 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine is CC(C)C1NOC(c2cccc(Br)c2)N1C.
What is the InChIKey of 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine?
The InChIKey is NLQMVIMFCUZKGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17BrN2O/c1-8(2)11-14-16-12(15(11)3)9-5-4-6-10(13)7-9/h4-8,11-12,14H,1-3H3.
What are the key properties of 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine?
5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine has a molecular weight of 285.19 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3-bromophenyl)-4-methyl-3-propan-2-yl-1,2,4-oxadiazolidine is sourced from PubChem (CID 167091870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).