C15H22O3 — CID 167093032
methyl (1R,6S,8R)-1,6-dimethyl-5-oxo-8-prop-1-en-2-ylbicyclo[2.2.2]octane-2-carboxylate (PubChem CID 167093032) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is methyl (1R,6S,8R)-1,6-dimethyl-5-oxo-8-prop-1-en-2-ylbicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl (1R,6S,8R)-1,6-dimethyl-5-oxo-8-prop-1-en-2-ylbicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 167093032 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | methyl (1R,6S,8R)-1,6-dimethyl-5-oxo-8-prop-1-en-2-ylbicyclo[2.2.2]octane-2-carboxylate |
| SMILES | C=C(C)[C@@H]1C[C@@]2(C)C(C(=O)OC)CC1C(=O)[C@H]2C |
| InChI | InChI=1S/C15H22O3/c1-8(2)11-7-15(4)9(3)13(16)10(11)6-12(15)14(17)18-5/h9-12H,1,6-7H2,2-5H3/t9-,10?,11+,12?,15-/m1/s1 |
| InChIKey | HXZOCZRXBWDKKO-KGDDGCRWSA-N |
| XLogP | 2.60 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|