C29H45NO4 — CID 167093033
methyl (4S,6S,8S)-2-[(E)-2-[(1S,3R,4R)-4-hydroxy-4-methyl-3-pyrrolidin-1-ylcyclohexyl]prop-1-enyl]-4,6-dimethyl-5-oxo-8-prop-1-en-2-ylbicyclo[2.2.2]octane-2-carboxylate (PubChem CID 167093033) has the molecular formula C29H45NO4 and a molecular weight of 471.68 g/mol. Its IUPAC name is methyl (4S,6S,8S)-2-[(E)-2-[(1S,3R,4R)-4-hydroxy-4-methyl-3-pyrrolidin-1-ylcyclohexyl]prop-1-enyl]-4,6-dimethyl-5-oxo-8-prop-1-en-2-ylbicyclo[2.2.2]octane-2-carboxylate.
| Compound Name | methyl (4S,6S,8S)-2-[(E)-2-[(1S,3R,4R)-4-hydroxy-4-methyl-3-pyrrolidin-1-ylcyclohexyl]prop-1-enyl]-4,6-dimethyl-5-oxo-8-prop-1-en-2-ylbicyclo[2.2.2]octane-2-carboxylate |
|---|---|
| PubChem CID | 167093033 |
| Molecular Formula | C29H45NO4 |
| Molecular Weight | 471.68 g/mol |
| Exact Mass | 471.33 |
| IUPAC Name | methyl (4S,6S,8S)-2-[(E)-2-[(1S,3R,4R)-4-hydroxy-4-methyl-3-pyrrolidin-1-ylcyclohexyl]prop-1-enyl]-4,6-dimethyl-5-oxo-8-prop-1-en-2-ylbicyclo[2.2.2]octane-2-carboxylate |
| SMILES | C=C(C)[C@@H]1CC2[C@H](C)C(=O)[C@@]1(C)CC2(/C=C(\C)[C@H]1CC[C@@](C)(O)[C@H](N2CCCC2)C1)C(=O)OC |
| InChI | InChI=1S/C29H45NO4/c1-18(2)22-15-23-20(4)25(31)27(22,5)17-29(23,26(32)34-7)16-19(3)21-10-11-28(6,33)24(14-21)30-12-8-9-13-30/h16,20-24,33H,1,8-15,17H2,2-7H3/b19-16+/t20-,21-,22-,23?,24+,27-,28+,29?/m0/s1 |
| InChIKey | VPMVEUJIOHRJLX-NFKXXXEISA-N |
| XLogP | 4.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.68 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|