About 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol
4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol (PubChem CID 167093539) has the molecular formula C6H11NO4
and a molecular weight of 161.16 g/mol. Its IUPAC name is 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol |
| PubChem CID | 167093539 |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol |
| SMILES | OCC1NCC2OC2(O)C1O |
| InChI | InChI=1S/C6H11NO4/c8-2-3-5(9)6(10)4(11-6)1-7-3/h3-5,7-10H,1-2H2 |
| InChIKey | WSDXKMDMGJPRRY-UHFFFAOYSA-N |
| XLogP | -2.60 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.16 |
| LogP ≤ 5 | -2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol?
The IUPAC name of 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol (CID 167093539) is 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol.
What is the SMILES notation for 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol?
The canonical SMILES for 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol is OCC1NCC2OC2(O)C1O.
What is the InChIKey of 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol?
The InChIKey is WSDXKMDMGJPRRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO4/c8-2-3-5(9)6(10)4(11-6)1-7-3/h3-5,7-10H,1-2H2.
What are the key properties of 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol?
4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol has a molecular weight of 161.16 g/mol, XLogP of -2.60, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-7-oxa-3-azabicyclo[4.1.0]heptane-5,6-diol is sourced from PubChem (CID 167093539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).