C17H26O4 — CID 167094224
methyl 2-hydroxy-2-[(4S)-1,5,5-trimethyl-6-oxo-4-prop-1-en-2-ylcyclohex-2-en-1-yl]butanoate (PubChem CID 167094224) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is methyl 2-hydroxy-2-[(4S)-1,5,5-trimethyl-6-oxo-4-prop-1-en-2-ylcyclohex-2-en-1-yl]butanoate.
| Compound Name | methyl 2-hydroxy-2-[(4S)-1,5,5-trimethyl-6-oxo-4-prop-1-en-2-ylcyclohex-2-en-1-yl]butanoate |
|---|---|
| PubChem CID | 167094224 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | methyl 2-hydroxy-2-[(4S)-1,5,5-trimethyl-6-oxo-4-prop-1-en-2-ylcyclohex-2-en-1-yl]butanoate |
| SMILES | C=C(C)[C@@H]1C=CC(C)(C(O)(CC)C(=O)OC)C(=O)C1(C)C |
| InChI | InChI=1S/C17H26O4/c1-8-17(20,14(19)21-7)16(6)10-9-12(11(2)3)15(4,5)13(16)18/h9-10,12,20H,2,8H2,1,3-7H3/t12-,16?,17?/m0/s1 |
| InChIKey | VLAHIQZTLWJXAP-CDEQTRAXSA-N |
| XLogP | 2.66 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|