C19H20N3O11PS — CID 167094555
(2,5-dioxopyrrolidin-1-yl) N-[[2-oxo-3-(2-phosphonooxyethylcarbamothioyloxymethyl)chromen-6-yl]methyl]carbamate (PubChem CID 167094555) has the molecular formula C19H20N3O11PS and a molecular weight of 529.42 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[[2-oxo-3-(2-phosphonooxyethylcarbamothioyloxymethyl)chromen-6-yl]methyl]carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[[2-oxo-3-(2-phosphonooxyethylcarbamothioyloxymethyl)chromen-6-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167094555 |
| Molecular Formula | C19H20N3O11PS |
| Molecular Weight | 529.42 g/mol |
| Exact Mass | 529.06 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[[2-oxo-3-(2-phosphonooxyethylcarbamothioyloxymethyl)chromen-6-yl]methyl]carbamate |
| SMILES | O=C(NCc1ccc2oc(=O)c(COC(=S)NCCOP(=O)(O)O)cc2c1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C19H20N3O11PS/c23-15-3-4-16(24)22(15)33-18(26)21-9-11-1-2-14-12(7-11)8-13(17(25)32-14)10-30-19(35)20-5-6-31-34(27,28)29/h1-2,7-8H,3-6,9-10H2,(H,20,35)(H,21,26)(H2,27,28,29) |
| InChIKey | QTHJEVITKLEVMU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 193.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.42 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|