About 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene
9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene (PubChem CID 167095127) has the molecular formula C25H22O
and a molecular weight of 338.45 g/mol. Its IUPAC name is 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene.
Molecular Properties
| Compound Name | 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene |
| PubChem CID | 167095127 |
| Molecular Formula | C25H22O |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene |
| SMILES | C/C=C\C=C(/C)C1(c2ccccc2)c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C25H22O/c1-3-4-12-19(2)25(20-13-6-5-7-14-20)21-15-8-10-17-23(21)26-24-18-11-9-16-22(24)25/h3-18H,1-2H3/b4-3-,19-12+ |
| InChIKey | NUFUIYCVZFUGBY-XCYFYWMJSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene?
The IUPAC name of 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene (CID 167095127) is 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene.
What is the SMILES notation for 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene?
The canonical SMILES for 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene is C/C=C\C=C(/C)C1(c2ccccc2)c2ccccc2Oc2ccccc21.
What is the InChIKey of 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene?
The InChIKey is NUFUIYCVZFUGBY-XCYFYWMJSA-N. The full InChI is InChI=1S/C25H22O/c1-3-4-12-19(2)25(20-13-6-5-7-14-20)21-15-8-10-17-23(21)26-24-18-11-9-16-22(24)25/h3-18H,1-2H3/b4-3-,19-12+.
What are the key properties of 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene?
9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene has a molecular weight of 338.45 g/mol, XLogP of 6.65, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[(2E,4Z)-hexa-2,4-dien-2-yl]-9-phenylxanthene is sourced from PubChem (CID 167095127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).