C7H12F3N3 — CID 167095335
N'-(1-aminopropan-2-yl)-N-ethenyl-2,2,2-trifluoroethanimidamide (PubChem CID 167095335) has the molecular formula C7H12F3N3 and a molecular weight of 195.19 g/mol. Its IUPAC name is N'-(1-aminopropan-2-yl)-N-ethenyl-2,2,2-trifluoroethanimidamide.
| Compound Name | N'-(1-aminopropan-2-yl)-N-ethenyl-2,2,2-trifluoroethanimidamide |
|---|---|
| PubChem CID | 167095335 |
| Molecular Formula | C7H12F3N3 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.10 |
| IUPAC Name | N'-(1-aminopropan-2-yl)-N-ethenyl-2,2,2-trifluoroethanimidamide |
| SMILES | C=CN/C(=N\C(C)CN)C(F)(F)F |
| InChI | InChI=1S/C7H12F3N3/c1-3-12-6(7(8,9)10)13-5(2)4-11/h3,5H,1,4,11H2,2H3,(H,12,13) |
| InChIKey | FYHHZQPALRMAMK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|