C30H42P4 — CID 167095524
(2S,4R)-1-[2-[(2R,4S)-2,4-dimethylphosphetan-1-yl]phenyl]-2-[[(2R,3S)-1-[2-[(2S,3R)-2,3-dimethylphosphiran-1-yl]phenyl]-3-methylphosphiran-2-yl]methyl]-2,4-dimethylphosphetane (PubChem CID 167095524) has the molecular formula C30H42P4 and a molecular weight of 526.56 g/mol. Its IUPAC name is (2S,4R)-1-[2-[(2R,4S)-2,4-dimethylphosphetan-1-yl]phenyl]-2-[[(2R,3S)-1-[2-[(2S,3R)-2,3-dimethylphosphiran-1-yl]phenyl]-3-methylphosphiran-2-yl]methyl]-2,4-dimethylphosphetane.
| Compound Name | (2S,4R)-1-[2-[(2R,4S)-2,4-dimethylphosphetan-1-yl]phenyl]-2-[[(2R,3S)-1-[2-[(2S,3R)-2,3-dimethylphosphiran-1-yl]phenyl]-3-methylphosphiran-2-yl]methyl]-2,4-dimethylphosphetane |
|---|---|
| PubChem CID | 167095524 |
| Molecular Formula | C30H42P4 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | (2S,4R)-1-[2-[(2R,4S)-2,4-dimethylphosphetan-1-yl]phenyl]-2-[[(2R,3S)-1-[2-[(2S,3R)-2,3-dimethylphosphiran-1-yl]phenyl]-3-methylphosphiran-2-yl]methyl]-2,4-dimethylphosphetane |
| SMILES | C[C@@H]1C[C@H](C)P1c1ccccc1P1[C@H](C)C[C@@]1(C)C[C@@H]1[C@H](C)P1c1ccccc1P1[C@H](C)[C@@H]1C |
| InChI | InChI=1S/C30H42P4/c1-19-16-20(2)31(19)27-14-10-11-15-28(27)34-21(3)17-30(34,7)18-29-24(6)33(29)26-13-9-8-12-25(26)32-22(4)23(32)5/h8-15,19-24,29H,16-18H2,1-7H3/t19-,20+,21-,22-,23+,24+,29-,30+,31?,32?,33?,34?/m1/s1 |
| InChIKey | GUXFWAPCQZADIB-AILAVQBISA-N |
| XLogP | 7.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|