About 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine
4-methylidene-5,6-dihydro-1H-2,3-benzoxazine (PubChem CID 167095661) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine.
Molecular Properties
| Compound Name | 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine |
| PubChem CID | 167095661 |
| Molecular Formula | C9H11NO |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.08 |
| IUPAC Name | 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine |
| SMILES | C=C1NOCC2=C1CCC=C2 |
| InChI | InChI=1S/C9H11NO/c1-7-9-5-3-2-4-8(9)6-11-10-7/h2,4,10H,1,3,5-6H2 |
| InChIKey | HTOLWVXOHCUVCC-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine?
The IUPAC name of 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine (CID 167095661) is 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine.
What is the SMILES notation for 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine?
The canonical SMILES for 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine is C=C1NOCC2=C1CCC=C2.
What is the InChIKey of 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine?
The InChIKey is HTOLWVXOHCUVCC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-7-9-5-3-2-4-8(9)6-11-10-7/h2,4,10H,1,3,5-6H2.
What are the key properties of 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine?
4-methylidene-5,6-dihydro-1H-2,3-benzoxazine has a molecular weight of 149.19 g/mol, XLogP of 1.68, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylidene-5,6-dihydro-1H-2,3-benzoxazine is sourced from PubChem (CID 167095661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).