C30H40F2N2O6 — CID 167096076
1-[[[(1R)-1-(4-cyclopropyl-3,5-dimethoxy-4,6-dimethylcyclohexa-1,5-dien-1-yl)ethyl]-(2-phenylmethoxyethyl)carbamoyl]amino]-3,3-difluorocyclobutane-1-carboxylic acid (PubChem CID 167096076) has the molecular formula C30H40F2N2O6 and a molecular weight of 562.65 g/mol. Its IUPAC name is 1-[[[(1R)-1-(4-cyclopropyl-3,5-dimethoxy-4,6-dimethylcyclohexa-1,5-dien-1-yl)ethyl]-(2-phenylmethoxyethyl)carbamoyl]amino]-3,3-difluorocyclobutane-1-carboxylic acid.
| Compound Name | 1-[[[(1R)-1-(4-cyclopropyl-3,5-dimethoxy-4,6-dimethylcyclohexa-1,5-dien-1-yl)ethyl]-(2-phenylmethoxyethyl)carbamoyl]amino]-3,3-difluorocyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 167096076 |
| Molecular Formula | C30H40F2N2O6 |
| Molecular Weight | 562.65 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | 1-[[[(1R)-1-(4-cyclopropyl-3,5-dimethoxy-4,6-dimethylcyclohexa-1,5-dien-1-yl)ethyl]-(2-phenylmethoxyethyl)carbamoyl]amino]-3,3-difluorocyclobutane-1-carboxylic acid |
| SMILES | COC1=C(C)C([C@@H](C)N(CCOCc2ccccc2)C(=O)NC2(C(=O)O)CC(F)(F)C2)=CC(OC)C1(C)C1CC1 |
| InChI | InChI=1S/C30H40F2N2O6/c1-19-23(15-24(38-4)28(3,22-11-12-22)25(19)39-5)20(2)34(13-14-40-16-21-9-7-6-8-10-21)27(37)33-29(26(35)36)17-30(31,32)18-29/h6-10,15,20,22,24H,11-14,16-18H2,1-5H3,(H,33,37)(H,35,36)/t20-,24?,28?/m1/s1 |
| InChIKey | BLNSEZCVTSXSAT-ZBYNABTRSA-N |
| XLogP | 5.15 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.65 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|