C47H81NO4 — CID 167096197
5-buta-1,2,3-trienylidene-4,6-dipentyl-18-(5-pyrrolidin-1-ylpentyl)-1,9-dioxacyclohexacosane-10,26-dione (PubChem CID 167096197) has the molecular formula C47H81NO4 and a molecular weight of 724.17 g/mol. Its IUPAC name is 5-buta-1,2,3-trienylidene-4,6-dipentyl-18-(5-pyrrolidin-1-ylpentyl)-1,9-dioxacyclohexacosane-10,26-dione.
| Compound Name | 5-buta-1,2,3-trienylidene-4,6-dipentyl-18-(5-pyrrolidin-1-ylpentyl)-1,9-dioxacyclohexacosane-10,26-dione |
|---|---|
| PubChem CID | 167096197 |
| Molecular Formula | C47H81NO4 |
| Molecular Weight | 724.17 g/mol |
| Exact Mass | 723.62 |
| IUPAC Name | 5-buta-1,2,3-trienylidene-4,6-dipentyl-18-(5-pyrrolidin-1-ylpentyl)-1,9-dioxacyclohexacosane-10,26-dione |
| SMILES | C=C=C=C=C1C(CCCCC)CCOC(=O)CCCCCCCC(CCCCCN2CCCC2)CCCCCCCC(=O)OCCC1CCCCC |
| InChI | InChI=1S/C47H81NO4/c1-4-7-17-30-43-35-40-51-46(49)33-22-14-10-12-19-27-42(29-21-16-24-37-48-38-25-26-39-48)28-20-13-11-15-23-34-47(50)52-41-36-44(31-18-8-5-2)45(43)32-9-6-3/h42-44H,3-5,7-8,10-31,33-41H2,1-2H3 |
| InChIKey | XLURDVOUQFKWES-UHFFFAOYSA-N |
| XLogP | 13.01 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.17 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|