C45H79NO5 — CID 167096244
5-buta-1,2,3-trienylidene-18-[3-(diethylamino)propoxy]-4,6-dipentyl-1,9-dioxacyclohexacosane-2,8-dione (PubChem CID 167096244) has the molecular formula C45H79NO5 and a molecular weight of 714.13 g/mol. Its IUPAC name is 5-buta-1,2,3-trienylidene-18-[3-(diethylamino)propoxy]-4,6-dipentyl-1,9-dioxacyclohexacosane-2,8-dione.
| Compound Name | 5-buta-1,2,3-trienylidene-18-[3-(diethylamino)propoxy]-4,6-dipentyl-1,9-dioxacyclohexacosane-2,8-dione |
|---|---|
| PubChem CID | 167096244 |
| Molecular Formula | C45H79NO5 |
| Molecular Weight | 714.13 g/mol |
| Exact Mass | 713.60 |
| IUPAC Name | 5-buta-1,2,3-trienylidene-18-[3-(diethylamino)propoxy]-4,6-dipentyl-1,9-dioxacyclohexacosane-2,8-dione |
| SMILES | C=C=C=C=C1C(CCCCC)CC(=O)OCCCCCCCCC(OCCCN(CC)CC)CCCCCCCCOC(=O)CC1CCCCC |
| InChI | InChI=1S/C45H79NO5/c1-6-11-22-29-40-38-44(47)50-35-26-20-16-14-18-24-31-42(49-37-28-34-46(9-4)10-5)32-25-19-15-17-21-27-36-51-45(48)39-41(30-23-12-7-2)43(40)33-13-8-3/h40-42H,3,6-7,9-12,14-32,34-39H2,1-2,4-5H3 |
| InChIKey | LGTFBEGGCFVJJB-UHFFFAOYSA-N |
| XLogP | 11.86 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.13 |
| LogP ≤ 5 | 11.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|