C44H75NO4 — CID 167096276
5-buta-1,2,3-trienylidene-4,6-dipentyl-18-(2-pyrrolidin-1-ylethyl)-1,9-dioxacyclohexacosane-10,26-dione (PubChem CID 167096276) has the molecular formula C44H75NO4 and a molecular weight of 682.09 g/mol. Its IUPAC name is 5-buta-1,2,3-trienylidene-4,6-dipentyl-18-(2-pyrrolidin-1-ylethyl)-1,9-dioxacyclohexacosane-10,26-dione.
| Compound Name | 5-buta-1,2,3-trienylidene-4,6-dipentyl-18-(2-pyrrolidin-1-ylethyl)-1,9-dioxacyclohexacosane-10,26-dione |
|---|---|
| PubChem CID | 167096276 |
| Molecular Formula | C44H75NO4 |
| Molecular Weight | 682.09 g/mol |
| Exact Mass | 681.57 |
| IUPAC Name | 5-buta-1,2,3-trienylidene-4,6-dipentyl-18-(2-pyrrolidin-1-ylethyl)-1,9-dioxacyclohexacosane-10,26-dione |
| SMILES | C=C=C=C=C1C(CCCCC)CCOC(=O)CCCCCCCC(CCN2CCCC2)CCCCCCCC(=O)OCCC1CCCCC |
| InChI | InChI=1S/C44H75NO4/c1-4-7-16-26-40-32-37-48-43(46)29-20-14-10-12-18-24-39(31-36-45-34-22-23-35-45)25-19-13-11-15-21-30-44(47)49-38-33-41(27-17-8-5-2)42(40)28-9-6-3/h39-41H,3-5,7-8,10-27,29-38H2,1-2H3 |
| InChIKey | KSAXTJDDYLJOBU-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.09 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|